* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB025795 |
| English Synonyms: | VITAS-BB TBB025795 |
| MDL Number.: | MFCD06118171 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | CC1=CC(C)=C(C)C(=C1C)S(=O)(=O)NC1=CC=C(C=C1)S(=O)(=O)N1CCCC2=C1C=CC=C2 |
| InChi: | InChI=1S/C25H28N2O4S2/c1-17-16-18(2)20(4)25(19(17)3)32(28,29)26-22-11-13-23(14-12-22)33(30,31)27-15-7-9-21-8-5-6-10-24(21)27/h5-6,8,10-14,16,26H,7,9,15H2,1-4H3 |
| InChiKey: | InChIKey=VNKXASVGRJNNQS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.