* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAMIN B17 |
| CAS: | 1332-94-1 |
| English Synonyms: | VITAMIN B17 ; LAETRILE |
| MDL Number.: | MFCD06198902 |
| H bond acceptor: | 8 |
| H bond donor: | 4 |
| Smile: | c1ccc(cc1)[C@@H](C#N)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)C(=O)O)O)O)O |
| InChi: | InChI=1S/C14H15NO7/c15-6-8(7-4-2-1-3-5-7)21-14-11(18)9(16)10(17)12(22-14)13(19)20/h1-5,8-12,14,16-18H,(H,19,20)/t8-,9+,10+,11-,12+,14-/m1/s1 |
| InChiKey: | InChIKey=XLSLFPQAPYONPW-CBIHJVFNSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.