* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BE 0695 |
English Synonyms: | RARECHEM AL BE 0695 |
MDL Number.: | MFCD06203280 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCC/C=C/C=C/C(=O)O |
InChi: | InChI=1S/C8H12O2/c1-2-3-4-5-6-7-8(9)10/h4-7H,2-3H2,1H3,(H,9,10)/b5-4+,7-6+ |
InChiKey: | InChIKey=QZGIOJSVUOCUMC-YTXTXJHMSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.