* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BE 1108 |
English Synonyms: | RARECHEM AL BE 1108 |
MDL Number.: | MFCD06203447 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | c1cc(c(c(c1)Cl)C(=O)Oc2ccc(cc2C(=O)O)[N+](=O)[O-])F |
InChi: | InChI=1S/C14H7ClFNO6/c15-9-2-1-3-10(16)12(9)14(20)23-11-5-4-7(17(21)22)6-8(11)13(18)19/h1-6H,(H,18,19) |
InChiKey: | InChIKey=WIPONFOLNKOBGL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.