* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BE 1214 |
English Synonyms: | RARECHEM AL BE 1214 |
MDL Number.: | MFCD06203526 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CCOC(=O)c1cc(oc1N)/C=C/C(=O)O |
InChi: | InChI=1S/C10H11NO5/c1-2-15-10(14)7-5-6(16-9(7)11)3-4-8(12)13/h3-5H,2,11H2,1H3,(H,12,13)/b4-3+ |
InChiKey: | InChIKey=FJEZKUIQVSIHST-ONEGZZNKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.