* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AL BE 1286 |
| English Synonyms: | RARECHEM AL BE 1286 |
| MDL Number.: | MFCD06203562 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | Cn1c(c(c(n1)C(F)(F)F)C(=O)O)Oc2ccc(cc2)Cl |
| InChi: | InChI=1S/C12H8ClF3N2O3/c1-18-10(21-7-4-2-6(13)3-5-7)8(11(19)20)9(17-18)12(14,15)16/h2-5H,1H3,(H,19,20) |
| InChiKey: | InChIKey=HTJWLXOHCXEICH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.