* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BF 1177 |
English Synonyms: | RARECHEM AL BF 1177 |
MDL Number.: | MFCD06204081 |
H bond acceptor: | 12 |
H bond donor: | 0 |
Smile: | COC(=O)c1ccc(c(c1)[N+](=O)[O-])N2CCN(CC2)c3ccc(cc3[N+](=O)[O-])C(=O)OC |
InChi: | InChI=1S/C20H20N4O8/c1-31-19(25)13-3-5-15(17(11-13)23(27)28)21-7-9-22(10-8-21)16-6-4-14(20(26)32-2)12-18(16)24(29)30/h3-6,11-12H,7-10H2,1-2H3 |
InChiKey: | InChIKey=SOQZMSUVZGWWJT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.