* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BF 1270 |
English Synonyms: | RARECHEM AL BF 1270 |
MDL Number.: | MFCD06204141 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | COC(=O)COCC(C(C(C(F)F)(F)F)(F)F)(F)F |
InChi: | InChI=1S/C8H8F8O3/c1-18-4(17)2-19-3-6(11,12)8(15,16)7(13,14)5(9)10/h5H,2-3H2,1H3 |
InChiKey: | InChIKey=JKMVBOXKGDEXMU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.