* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BF 1270 |
| EnglishSynonyms: | RARECHEM AL BF 1270 |
| pro_mdlNumber: | MFCD06204141 |
| pro_acceptors: | 3 |
| pro_donors: | 0 |
| pro_smile: | COC(=O)COCC(C(C(C(F)F)(F)F)(F)F)(F)F |
| InChi: | InChI=1S/C8H8F8O3/c1-18-4(17)2-19-3-6(11,12)8(15,16)7(13,14)5(9)10/h5H,2-3H2,1H3 |
| InChiKey: | InChIKey=JKMVBOXKGDEXMU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.