* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BF 1313 |
English Synonyms: | RARECHEM AL BF 1313 |
MDL Number.: | MFCD06204175 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | COC(=O)c1c[nH]nc1c2ccc(cc2)C(F)(F)F |
InChi: | InChI=1S/C12H9F3N2O2/c1-19-11(18)9-6-16-17-10(9)7-2-4-8(5-3-7)12(13,14)15/h2-6H,1H3,(H,16,17) |
InChiKey: | InChIKey=ZBNRBPJVJXKRRT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.