* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BI 0920 |
English Synonyms: | RARECHEM AL BI 0920 |
MDL Number.: | MFCD06204791 |
H bond acceptor: | 7 |
H bond donor: | 0 |
Smile: | CCOC(=O)c1ccc(cc1[N+](=O)[O-])C(=O)OC |
InChi: | InChI=1S/C11H11NO6/c1-3-18-11(14)8-5-4-7(10(13)17-2)6-9(8)12(15)16/h4-6H,3H2,1-2H3 |
InChiKey: | InChIKey=JUBLIHPJSHSOMK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.