* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BI 0925 |
English Synonyms: | RARECHEM AL BI 0925 |
MDL Number.: | MFCD06204794 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCOC(=O)c1cc(cc(c1O)OC)I |
InChi: | InChI=1S/C10H11IO4/c1-3-15-10(13)7-4-6(11)5-8(14-2)9(7)12/h4-5,12H,3H2,1-2H3 |
InChiKey: | InChIKey=JIHGYQRVZMDTQQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.