* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BI 0937 |
English Synonyms: | RARECHEM AL BI 0937 |
MDL Number.: | MFCD06204803 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCOC(=O)c1cccc(c1O)CC=C |
InChi: | InChI=1S/C12H14O3/c1-3-6-9-7-5-8-10(11(9)13)12(14)15-4-2/h3,5,7-8,13H,1,4,6H2,2H3 |
InChiKey: | InChIKey=NRQZXKHAOYHGHQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.