* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BI 0956 |
English Synonyms: | RARECHEM AL BI 0956 |
MDL Number.: | MFCD06204817 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | CCOC(=O)c1cc(ccc1Oc2ccc(cc2)C(C)(C)C)[N+](=O)[O-] |
InChi: | InChI=1S/C19H21NO5/c1-5-24-18(21)16-12-14(20(22)23)8-11-17(16)25-15-9-6-13(7-10-15)19(2,3)4/h6-12H,5H2,1-4H3 |
InChiKey: | InChIKey=JEROBLHTLFJNHW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.