* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BI 1066 |
English Synonyms: | RARECHEM AL BI 1066 |
MDL Number.: | MFCD06204905 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | CCOC(=O)/C(=C\N(C)C)/C(=C/N(C)C)/C(=O)OCC |
InChi: | InChI=1S/C14H24N2O4/c1-7-19-13(17)11(9-15(3)4)12(10-16(5)6)14(18)20-8-2/h9-10H,7-8H2,1-6H3/b11-9-,12-10- |
InChiKey: | InChIKey=MJPNRYBDMWBIEG-HWAYABPNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.