* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BI 1089 |
English Synonyms: | RARECHEM AL BI 1089 |
MDL Number.: | MFCD06204925 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | CCOC(=O)c1cccn1c2ccc(cc2)[N+](=O)[O-] |
InChi: | InChI=1S/C13H12N2O4/c1-2-19-13(16)12-4-3-9-14(12)10-5-7-11(8-6-10)15(17)18/h3-9H,2H2,1H3 |
InChiKey: | InChIKey=KTVFFGXFVSYVCC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.