* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BI 1113 |
English Synonyms: | RARECHEM AL BI 1113 |
MDL Number.: | MFCD06204945 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | CCOC(=O)c1cccc(c1)OCCBr |
InChi: | InChI=1S/C11H13BrO3/c1-2-14-11(13)9-4-3-5-10(8-9)15-7-6-12/h3-5,8H,2,6-7H2,1H3 |
InChiKey: | InChIKey=VSNPACRLJKTQBA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.