* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BK 0776 |
English Synonyms: | RARECHEM AL BK 0776 |
MDL Number.: | MFCD06205428 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | c1ccc2c(c1)c(=O)c(c(o2)N)/C=C/C(=O)O |
InChi: | InChI=1S/C12H9NO4/c13-12-8(5-6-10(14)15)11(16)7-3-1-2-4-9(7)17-12/h1-6H,13H2,(H,14,15)/b6-5+ |
InChiKey: | InChIKey=RFYQGHWBTUUTOG-AATRIKPKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.