* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BK 0782 |
English Synonyms: | RARECHEM AL BK 0782 |
MDL Number.: | MFCD06205434 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | Cc1cc(c(n1c2cccc(c2)C(F)(F)F)C)/C=C/C(=O)O |
InChi: | InChI=1S/C16H14F3NO2/c1-10-8-12(6-7-15(21)22)11(2)20(10)14-5-3-4-13(9-14)16(17,18)19/h3-9H,1-2H3,(H,21,22)/b7-6+ |
InChiKey: | InChIKey=HJMNILSAGGKQFP-VOTSOKGWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.