* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BK 0888 |
English Synonyms: | RARECHEM AL BK 0888 |
MDL Number.: | MFCD06205470 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | C1COCC1/C=C/C(=O)O |
InChi: | InChI=1S/C7H10O3/c8-7(9)2-1-6-3-4-10-5-6/h1-2,6H,3-5H2,(H,8,9)/b2-1+ |
InChiKey: | InChIKey=KMUGSVLWKSIBEG-OWOJBTEDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.