* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BK 0930 |
English Synonyms: | RARECHEM AL BK 0930 |
MDL Number.: | MFCD06205496 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1ccc(c(c1)/C=C/C(=O)O)OCc2c(cccc2Cl)F |
InChi: | InChI=1S/C16H12ClFO3/c17-13-5-3-6-14(18)12(13)10-21-15-7-2-1-4-11(15)8-9-16(19)20/h1-9H,10H2,(H,19,20)/b9-8+ |
InChiKey: | InChIKey=KTEHZTCZSNSMEM-CMDGGOBGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.