* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BK 0950 |
English Synonyms: | RARECHEM AL BK 0950 |
MDL Number.: | MFCD06205506 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | c1c(cc(c(c1/C=C/C(=O)O)O)Br)[N+](=O)[O-] |
InChi: | InChI=1S/C9H6BrNO5/c10-7-4-6(11(15)16)3-5(9(7)14)1-2-8(12)13/h1-4,14H,(H,12,13)/b2-1+ |
InChiKey: | InChIKey=MGIRHKWYAZMYKI-OWOJBTEDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.