* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BK 0984 |
English Synonyms: | RARECHEM AL BK 0984 |
MDL Number.: | MFCD06205527 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1cc(c(c(c1)F)C(=O)Oc2ccc(cc2/C=C/C(=O)O)Br)F |
InChi: | InChI=1S/C16H9BrF2O4/c17-10-5-6-13(9(8-10)4-7-14(20)21)23-16(22)15-11(18)2-1-3-12(15)19/h1-8H,(H,20,21)/b7-4+ |
InChiKey: | InChIKey=AZFLDODJQKCZSP-QPJJXVBHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.