* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BK 1021 |
| EnglishSynonyms: | RARECHEM AL BK 1021 |
| pro_mdlNumber: | MFCD06205551 |
| pro_acceptors: | 4 |
| pro_donors: | 1 |
| pro_smile: | CC(C)(C)c1ccc(cc1)CSc2c(c(nn2C)C(F)(F)F)/C=C/C(=O)O |
| InChi: | InChI=1S/C19H21F3N2O2S/c1-18(2,3)13-7-5-12(6-8-13)11-27-17-14(9-10-15(25)26)16(19(20,21)22)23-24(17)4/h5-10H,11H2,1-4H3,(H,25,26)/b10-9+ |
| InChiKey: | InChIKey=OWWCLGXISPKUQM-MDZDMXLPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.