* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BK 1041 |
English Synonyms: | RARECHEM AL BK 1041 |
MDL Number.: | MFCD06205558 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | COC(=O)Cc1c(c([nH]c1Cl)/C=C/C(=O)O)C(=O)OC |
InChi: | InChI=1S/C12H12ClNO6/c1-19-9(17)5-6-10(12(18)20-2)7(14-11(6)13)3-4-8(15)16/h3-4,14H,5H2,1-2H3,(H,15,16)/b4-3+ |
InChiKey: | InChIKey=FJEWLIINBSNGPU-ONEGZZNKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.