* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BK 1042 |
English Synonyms: | RARECHEM AL BK 1042 |
MDL Number.: | MFCD06205559 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | Cc1cccc(c1)C2CC(=O)C(=C(S2)SCC#C)/C=C/C(=O)O |
InChi: | InChI=1S/C18H16O3S2/c1-3-9-22-18-14(7-8-17(20)21)15(19)11-16(23-18)13-6-4-5-12(2)10-13/h1,4-8,10,16H,9,11H2,2H3,(H,20,21)/b8-7+ |
InChiKey: | InChIKey=OPSXJJKEUAVKRA-BQYQJAHWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.