* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BK 1069 |
English Synonyms: | RARECHEM AL BK 1069 |
MDL Number.: | MFCD06205577 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | Cn1c(c(c(n1)C(F)(F)F)/C=C/C(=O)O)Oc2cccc(c2)Cl |
InChi: | InChI=1S/C14H10ClF3N2O3/c1-20-13(23-9-4-2-3-8(15)7-9)10(5-6-11(21)22)12(19-20)14(16,17)18/h2-7H,1H3,(H,21,22)/b6-5+ |
InChiKey: | InChIKey=WISFNZNKDWZNLG-AATRIKPKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.