* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BK 1085 |
English Synonyms: | RARECHEM AL BK 1085 |
MDL Number.: | MFCD06205586 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | c1cc(c(cc1[N+](=O)[O-])/C=C/C(=O)O)N2CCCCC2 |
InChi: | InChI=1S/C14H16N2O4/c17-14(18)7-4-11-10-12(16(19)20)5-6-13(11)15-8-2-1-3-9-15/h4-7,10H,1-3,8-9H2,(H,17,18)/b7-4+ |
InChiKey: | InChIKey=RBEHKPLKSJBCPS-QPJJXVBHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.