* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BK 1113 |
English Synonyms: | RARECHEM AL BK 1113 |
MDL Number.: | MFCD06205602 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1cc(cc(c1)OCCBr)/C=C/C(=O)O |
InChi: | InChI=1S/C11H11BrO3/c12-6-7-15-10-3-1-2-9(8-10)4-5-11(13)14/h1-5,8H,6-7H2,(H,13,14)/b5-4+ |
InChiKey: | InChIKey=SFROETMTZIAZHQ-SNAWJCMRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.