* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BK 1169 |
English Synonyms: | RARECHEM AL BK 1169 |
MDL Number.: | MFCD06205639 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)Cn2cc(c3c2ccc(c3)[N+](=O)[O-])/C=C/C(=O)O |
InChi: | InChI=1S/C18H14N2O4/c21-18(22)9-6-14-12-19(11-13-4-2-1-3-5-13)17-8-7-15(20(23)24)10-16(14)17/h1-10,12H,11H2,(H,21,22)/b9-6+ |
InChiKey: | InChIKey=UUXABLWXCLOEEC-RMKNXTFCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.