* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BL 0511 |
English Synonyms: | RARECHEM AL BL 0511 |
MDL Number.: | MFCD06206160 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | Cc1c(cc(c(c1F)F)C(CC(=O)O)N)Cl |
InChi: | InChI=1S/C10H10ClF2NO2/c1-4-6(11)2-5(10(13)9(4)12)7(14)3-8(15)16/h2,7H,3,14H2,1H3,(H,15,16) |
InChiKey: | InChIKey=KRPMCNGEICQCPU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.