* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BL 0533 |
English Synonyms: | RARECHEM AL BL 0533 |
MDL Number.: | MFCD06206171 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CCCCC/C=C\CCC(CC(=O)O)N |
InChi: | InChI=1S/C12H23NO2/c1-2-3-4-5-6-7-8-9-11(13)10-12(14)15/h6-7,11H,2-5,8-10,13H2,1H3,(H,14,15)/b7-6- |
InChiKey: | InChIKey=STDFZCHWTXNFNZ-SREVYHEPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.