* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BL 0538 |
English Synonyms: | RARECHEM AL BL 0538 |
MDL Number.: | MFCD06206174 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CCC(CC=C)/C=C(\CC)/C(CC(=O)O)N |
InChi: | InChI=1S/C13H23NO2/c1-4-7-10(5-2)8-11(6-3)12(14)9-13(15)16/h4,8,10,12H,1,5-7,9,14H2,2-3H3,(H,15,16)/b11-8+ |
InChiKey: | InChIKey=PNIKJOKWKZVGSW-DHZHZOJOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.