* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AL BL 0556 |
| English Synonyms: | RARECHEM AL BL 0556 |
| MDL Number.: | MFCD06206187 |
| H bond acceptor: | 6 |
| H bond donor: | 4 |
| Smile: | c1ccc2c(c1)c(c3ccccc3c2C(CC(=O)O)N)C(CC(=O)O)N |
| InChi: | InChI=1S/C20H20N2O4/c21-15(9-17(23)24)19-11-5-1-2-6-12(11)20(16(22)10-18(25)26)14-8-4-3-7-13(14)19/h1-8,15-16H,9-10,21-22H2,(H,23,24)(H,25,26) |
| InChiKey: | InChIKey=IFRAARPSKHRBHH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.