* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AL BL 0559 |
| English Synonyms: | RARECHEM AL BL 0559 |
| MDL Number.: | MFCD06206190 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | CCOC(C#CC(CC(=O)O)N)OCC |
| InChi: | InChI=1S/C10H17NO4/c1-3-14-10(15-4-2)6-5-8(11)7-9(12)13/h8,10H,3-4,7,11H2,1-2H3,(H,12,13) |
| InChiKey: | InChIKey=RHMCOSJKRYVUBW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.