* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BL 0560 |
English Synonyms: | RARECHEM AL BL 0560 |
MDL Number.: | MFCD06206191 |
H bond acceptor: | 7 |
H bond donor: | 5 |
Smile: | c1c(cc(c(c1C(CC(=O)O)N)O)C(CC(=O)O)N)Cl |
InChi: | InChI=1S/C12H15ClN2O5/c13-5-1-6(8(14)3-10(16)17)12(20)7(2-5)9(15)4-11(18)19/h1-2,8-9,20H,3-4,14-15H2,(H,16,17)(H,18,19) |
InChiKey: | InChIKey=KUVPAOHSJJAVCL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.