* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BL 0580 |
English Synonyms: | RARECHEM AL BL 0580 |
MDL Number.: | MFCD06206207 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CCCCCCCCOc1ccc(cc1OCCCCCCCC)C(CC(=O)O)N |
InChi: | InChI=1S/C25H43NO4/c1-3-5-7-9-11-13-17-29-23-16-15-21(22(26)20-25(27)28)19-24(23)30-18-14-12-10-8-6-4-2/h15-16,19,22H,3-14,17-18,20,26H2,1-2H3,(H,27,28) |
InChiKey: | InChIKey=NWORVPDJOZRICJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.