* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BL 0628 |
English Synonyms: | RARECHEM AL BL 0628 |
MDL Number.: | MFCD06206245 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CCCCCCC(C(CC(=O)O)N)(Cl)Cl |
InChi: | InChI=1S/C10H19Cl2NO2/c1-2-3-4-5-6-10(11,12)8(13)7-9(14)15/h8H,2-7,13H2,1H3,(H,14,15) |
InChiKey: | InChIKey=OOGWJOIVNMPLTJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.