* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BL 0634 |
English Synonyms: | RARECHEM AL BL 0634 |
MDL Number.: | MFCD06206251 |
H bond acceptor: | 6 |
H bond donor: | 4 |
Smile: | Cc1cc(sc1c2c(cc(s2)C(CC(=O)O)N)C)C(CC(=O)O)N |
InChi: | InChI=1S/C16H20N2O4S2/c1-7-3-11(9(17)5-13(19)20)23-15(7)16-8(2)4-12(24-16)10(18)6-14(21)22/h3-4,9-10H,5-6,17-18H2,1-2H3,(H,19,20)(H,21,22) |
InChiKey: | InChIKey=CLQQMJQZOYATEG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.