* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BL 0685 |
English Synonyms: | RARECHEM AL BL 0685 |
MDL Number.: | MFCD06206286 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CC(=CCC/C(=C/CC/C(=C/C(CC(=O)O)N)/C)/C)C |
InChi: | InChI=1S/C17H29NO2/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-16(18)12-17(19)20/h7,9,11,16H,5-6,8,10,12,18H2,1-4H3,(H,19,20)/b14-9+,15-11+ |
InChiKey: | InChIKey=YAELLNPFKQTSHT-YFVJMOTDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.