* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BL 0717 |
English Synonyms: | RARECHEM AL BL 0717 |
MDL Number.: | MFCD06206307 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | COc1cc(ccc1O)/C=C/C(CC(=O)O)N |
InChi: | InChI=1S/C12H15NO4/c1-17-11-6-8(3-5-10(11)14)2-4-9(13)7-12(15)16/h2-6,9,14H,7,13H2,1H3,(H,15,16)/b4-2+ |
InChiKey: | InChIKey=VWACPKGGRDDYIU-DUXPYHPUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.