* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BL 0757 |
English Synonyms: | RARECHEM AL BL 0757 |
MDL Number.: | MFCD06206335 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | Cc1cc2c(cc1C)oc(c(c2=O)C(CC(=O)O)N)N |
InChi: | InChI=1S/C14H16N2O4/c1-6-3-8-10(4-7(6)2)20-14(16)12(13(8)19)9(15)5-11(17)18/h3-4,9H,5,15-16H2,1-2H3,(H,17,18) |
InChiKey: | InChIKey=JFAWOIZVZRSYRE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.