* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BL 0772 |
English Synonyms: | RARECHEM AL BL 0772 |
MDL Number.: | MFCD06206348 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | c1c2c3c(c(c1C(CC(=O)O)N)O)CCCN3CCC2 |
InChi: | InChI=1S/C15H20N2O3/c16-12(8-13(18)19)11-7-9-3-1-5-17-6-2-4-10(14(9)17)15(11)20/h7,12,20H,1-6,8,16H2,(H,18,19) |
InChiKey: | InChIKey=LKWAEYZWGGRDTD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.