* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BL 0793 |
English Synonyms: | RARECHEM AL BL 0793 |
MDL Number.: | MFCD06206365 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | COc1c(cc(c(c1Br)O)C(CC(=O)O)N)Br |
InChi: | InChI=1S/C10H11Br2NO4/c1-17-10-5(11)2-4(9(16)8(10)12)6(13)3-7(14)15/h2,6,16H,3,13H2,1H3,(H,14,15) |
InChiKey: | InChIKey=YLTCLCMGLICHGI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.