* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BL 0794 |
English Synonyms: | RARECHEM AL BL 0794 |
MDL Number.: | MFCD06206366 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | c1ccc(cc1)S(=O)(=O)n2cccc2C(CC(=O)O)N |
InChi: | InChI=1S/C13H14N2O4S/c14-11(9-13(16)17)12-7-4-8-15(12)20(18,19)10-5-2-1-3-6-10/h1-8,11H,9,14H2,(H,16,17) |
InChiKey: | InChIKey=NRIFQLJGPRRARG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.