* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BL 0796 |
English Synonyms: | RARECHEM AL BL 0796 |
MDL Number.: | MFCD06206367 |
H bond acceptor: | 8 |
H bond donor: | 4 |
Smile: | c1cnc(cc1C(CC(=O)O)N)c2cc(ccn2)C(CC(=O)O)N |
InChi: | InChI=1S/C16H18N4O4/c17-11(7-15(21)22)9-1-3-19-13(5-9)14-6-10(2-4-20-14)12(18)8-16(23)24/h1-6,11-12H,7-8,17-18H2,(H,21,22)(H,23,24) |
InChiKey: | InChIKey=NWXPNMAJWJLQAU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.