* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BL 0797 |
English Synonyms: | RARECHEM AL BL 0797 |
MDL Number.: | MFCD06206368 |
H bond acceptor: | 4 |
H bond donor: | 3 |
Smile: | c1ccc2c(c1)c(c([nH]2)c3ccc(cc3)F)C(CC(=O)O)N |
InChi: | InChI=1S/C17H15FN2O2/c18-11-7-5-10(6-8-11)17-16(13(19)9-15(21)22)12-3-1-2-4-14(12)20-17/h1-8,13,20H,9,19H2,(H,21,22) |
InChiKey: | InChIKey=CFSJVXMLBAHGDU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.