* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BL 0849 |
English Synonyms: | RARECHEM AL BL 0849 |
MDL Number.: | MFCD06206390 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | c1cc(ccc1COc2ccc(cc2)C(CC(=O)O)N)Br |
InChi: | InChI=1S/C16H16BrNO3/c17-13-5-1-11(2-6-13)10-21-14-7-3-12(4-8-14)15(18)9-16(19)20/h1-8,15H,9-10,18H2,(H,19,20) |
InChiKey: | InChIKey=NZHCQXUHWTXNPK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.