* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AL BM 0034 |
| English Synonyms: | RARECHEM AL BM 0034 |
| MDL Number.: | MFCD06206982 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CCOc1cccc(c1O)/C=C(\C)/C(=O)O |
| InChi: | InChI=1S/C12H14O4/c1-3-16-10-6-4-5-9(11(10)13)7-8(2)12(14)15/h4-7,13H,3H2,1-2H3,(H,14,15)/b8-7+ |
| InChiKey: | InChIKey=TXDHZGFEYSLXKO-BQYQJAHWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.