* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AL BM 0037 |
| English Synonyms: | RARECHEM AL BM 0037 |
| MDL Number.: | MFCD06206985 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CCN(CC)c1ccc(c(c1)O)/C=C(\C)/C(=O)O |
| InChi: | InChI=1S/C14H19NO3/c1-4-15(5-2)12-7-6-11(13(16)9-12)8-10(3)14(17)18/h6-9,16H,4-5H2,1-3H3,(H,17,18)/b10-8+ |
| InChiKey: | InChIKey=JAEWDFYDSACHDN-CSKARUKUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.