* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BM 0166 |
English Synonyms: | RARECHEM AL BM 0166 |
MDL Number.: | MFCD06207054 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCCCCCC/C=C(\C)/C(=O)O |
InChi: | InChI=1S/C11H20O2/c1-3-4-5-6-7-8-9-10(2)11(12)13/h9H,3-8H2,1-2H3,(H,12,13)/b10-9+ |
InChiKey: | InChIKey=QJVRRTMNQYLNDW-MDZDMXLPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.